About cyclopentyl acetate;methyl 2-methylprop-2-enoate
cyclopentyl acetate;methyl 2-methylprop-2-enoate (PubChem CID 174985649) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is cyclopentyl acetate;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | cyclopentyl acetate;methyl 2-methylprop-2-enoate |
| PubChem CID | 174985649 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | cyclopentyl acetate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.CC(=O)OC1CCCC1 |
| InChI | InChI=1S/C7H12O2.C5H8O2/c1-6(8)9-7-4-2-3-5-7;1-4(2)5(6)7-3/h7H,2-5H2,1H3;1H2,2-3H3 |
| InChIKey | KLZQLGBYLRZUQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl acetate;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl acetate;methyl 2-methylprop-2-enoate?
The IUPAC name of cyclopentyl acetate;methyl 2-methylprop-2-enoate (CID 174985649) is cyclopentyl acetate;methyl 2-methylprop-2-enoate.
What is the SMILES notation for cyclopentyl acetate;methyl 2-methylprop-2-enoate?
The canonical SMILES for cyclopentyl acetate;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.CC(=O)OC1CCCC1.
What is the InChIKey of cyclopentyl acetate;methyl 2-methylprop-2-enoate?
The InChIKey is KLZQLGBYLRZUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C5H8O2/c1-6(8)9-7-4-2-3-5-7;1-4(2)5(6)7-3/h7H,2-5H2,1H3;1H2,2-3H3.
What are the key properties of cyclopentyl acetate;methyl 2-methylprop-2-enoate?
cyclopentyl acetate;methyl 2-methylprop-2-enoate has a molecular weight of 228.29 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl acetate;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 174985649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).