C17H21F3O — CID 139864662
2-methoxy-6-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139864662) has the molecular formula C17H21F3O and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-methoxy-6-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-methoxy-6-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139864662 |
| Molecular Formula | C17H21F3O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-methoxy-6-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | COC1CCC2CC(c3cc(F)c(F)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C17H21F3O/c1-21-14-5-4-10-6-11(2-3-12(10)7-14)13-8-15(18)17(20)16(19)9-13/h8-12,14H,2-7H2,1H3 |
| InChIKey | HNWVFHFAPVRYIN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|