C17H20F2O2 — CID 139838671
6-(3,5-difluoro-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one (PubChem CID 139838671) has the molecular formula C17H20F2O2 and a molecular weight of 294.34 g/mol. Its IUPAC name is 6-(3,5-difluoro-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one.
| Compound Name | 6-(3,5-difluoro-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 139838671 |
| Molecular Formula | C17H20F2O2 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 6-(3,5-difluoro-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
| SMILES | COc1c(F)cc(C2CCC3CC(=O)CCC3C2)cc1F |
| InChI | InChI=1S/C17H20F2O2/c1-21-17-15(18)8-13(9-16(17)19)11-2-3-12-7-14(20)5-4-10(12)6-11/h8-12H,2-7H2,1H3 |
| InChIKey | SWWZQHGAVKTBCF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |