C20H23F5O — CID 22382930
2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22382930) has the molecular formula C20H23F5O and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22382930 |
| Molecular Formula | C20H23F5O |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3cc(F)c(OC(F)(F)F)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C20H23F5O/c1-2-3-12-4-5-14-9-15(7-6-13(14)8-12)16-10-17(21)19(18(22)11-16)26-20(23,24)25/h2-3,10-15H,4-9H2,1H3/b3-2+ |
| InChIKey | XMRSAEHWOFKKPZ-NSCUHMNNSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|