C20H21F3N2O5 — CID 141172728
4-but-3-enoyl-3-(3-ethoxy-3-oxoprop-1-enyl)-5-(3,4,5-trifluorophenyl)piperazine-1-carboxylic acid (PubChem CID 141172728) has the molecular formula C20H21F3N2O5 and a molecular weight of 426.39 g/mol. Its IUPAC name is 4-but-3-enoyl-3-(3-ethoxy-3-oxoprop-1-enyl)-5-(3,4,5-trifluorophenyl)piperazine-1-carboxylic acid.
| Compound Name | 4-but-3-enoyl-3-(3-ethoxy-3-oxoprop-1-enyl)-5-(3,4,5-trifluorophenyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141172728 |
| Molecular Formula | C20H21F3N2O5 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-but-3-enoyl-3-(3-ethoxy-3-oxoprop-1-enyl)-5-(3,4,5-trifluorophenyl)piperazine-1-carboxylic acid |
| SMILES | C=CCC(=O)N1C(C=CC(=O)OCC)CN(C(=O)O)CC1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H21F3N2O5/c1-3-5-17(26)25-13(6-7-18(27)30-4-2)10-24(20(28)29)11-16(25)12-8-14(21)19(23)15(22)9-12/h3,6-9,13,16H,1,4-5,10-11H2,2H3,(H,28,29) |
| InChIKey | QKDUOPILWCMWQY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|