C19H19F2N — CID 54202176
4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2,6-difluorobenzonitrile (PubChem CID 54202176) has the molecular formula C19H19F2N and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 54202176 |
| Molecular Formula | C19H19F2N |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2,6-difluorobenzonitrile |
| SMILES | CCC1CCC(C=CC#Cc2cc(F)c(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C19H19F2N/c1-2-14-7-9-15(10-8-14)5-3-4-6-16-11-18(20)17(13-22)19(21)12-16/h3,5,11-12,14-15H,2,7-10H2,1H3 |
| InChIKey | PQAHCVGFTFDTGS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|