C28H39F2N — CID 54532479
2,6-difluoro-4-[4-[2-(4-heptylcyclohexyl)ethenyl]cyclohexyl]benzonitrile (PubChem CID 54532479) has the molecular formula C28H39F2N and a molecular weight of 427.62 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[2-(4-heptylcyclohexyl)ethenyl]cyclohexyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[4-[2-(4-heptylcyclohexyl)ethenyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54532479 |
| Molecular Formula | C28H39F2N |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | 2,6-difluoro-4-[4-[2-(4-heptylcyclohexyl)ethenyl]cyclohexyl]benzonitrile |
| SMILES | CCCCCCCC1CCC(C=CC2CCC(c3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H39F2N/c1-2-3-4-5-6-7-21-8-10-22(11-9-21)12-13-23-14-16-24(17-15-23)25-18-27(29)26(20-31)28(30)19-25/h12-13,18-19,21-24H,2-11,14-17H2,1H3 |
| InChIKey | YXMISLICQHUHRD-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|