C24H29F2N — CID 67741326
2,6-difluoro-4-[4-[(E)-2-(4-prop-2-enylcyclohexyl)ethenyl]cyclohexyl]benzonitrile (PubChem CID 67741326) has the molecular formula C24H29F2N and a molecular weight of 369.50 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[(E)-2-(4-prop-2-enylcyclohexyl)ethenyl]cyclohexyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[4-[(E)-2-(4-prop-2-enylcyclohexyl)ethenyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 67741326 |
| Molecular Formula | C24H29F2N |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2,6-difluoro-4-[4-[(E)-2-(4-prop-2-enylcyclohexyl)ethenyl]cyclohexyl]benzonitrile |
| SMILES | C=CCC1CCC(/C=C/C2CCC(c3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H29F2N/c1-2-3-17-4-6-18(7-5-17)8-9-19-10-12-20(13-11-19)21-14-23(25)22(16-27)24(26)15-21/h2,8-9,14-15,17-20H,1,3-7,10-13H2/b9-8+ |
| InChIKey | ZNNCPZQTXKOUKB-CMDGGOBGSA-N |
| XLogP | 7.05 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|