C17H17F2N — CID 173325637
4-(4-buta-1,3-dienylcyclohexyl)-2,6-difluorobenzonitrile (PubChem CID 173325637) has the molecular formula C17H17F2N and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-(4-buta-1,3-dienylcyclohexyl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(4-buta-1,3-dienylcyclohexyl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 173325637 |
| Molecular Formula | C17H17F2N |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-(4-buta-1,3-dienylcyclohexyl)-2,6-difluorobenzonitrile |
| SMILES | C=CC=CC1CCC(c2cc(F)c(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C17H17F2N/c1-2-3-4-12-5-7-13(8-6-12)14-9-16(18)15(11-20)17(19)10-14/h2-4,9-10,12-13H,1,5-8H2 |
| InChIKey | FFVSXGYFBADXAL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|