C20H23F2N — CID 58840162
2,6-difluoro-4-[1,3,3-trideuterio-6-[(E)-prop-1-enyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzonitrile (PubChem CID 58840162) has the molecular formula C20H23F2N and a molecular weight of 318.43 g/mol. Its IUPAC name is 2,6-difluoro-4-[1,3,3-trideuterio-6-[(E)-prop-1-enyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[1,3,3-trideuterio-6-[(E)-prop-1-enyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 58840162 |
| Molecular Formula | C20H23F2N |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2,6-difluoro-4-[1,3,3-trideuterio-6-[(E)-prop-1-enyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzonitrile |
| SMILES | [2H]C1C2CCC(/C=C/C)CC2CC([2H])([2H])C1c1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C20H23F2N/c1-2-3-13-4-5-15-9-16(7-6-14(15)8-13)17-10-19(21)18(12-23)20(22)11-17/h2-3,10-11,13-16H,4-9H2,1H3/b3-2+/i7D2,9D |
| InChIKey | RMLHUYJIKXZOMJ-DZGOKRAOSA-N |
| XLogP | 5.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|