C17H19F3 — CID 173325624
1-(4-buta-1,3-dienylcyclohexyl)-4-(trifluoromethyl)benzene (PubChem CID 173325624) has the molecular formula C17H19F3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(4-buta-1,3-dienylcyclohexyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(4-buta-1,3-dienylcyclohexyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 173325624 |
| Molecular Formula | C17H19F3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-(4-buta-1,3-dienylcyclohexyl)-4-(trifluoromethyl)benzene |
| SMILES | C=CC=CC1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H19F3/c1-2-3-4-13-5-7-14(8-6-13)15-9-11-16(12-10-15)17(18,19)20/h2-4,9-14H,1,5-8H2 |
| InChIKey | CVHQSDOASVNGKT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|