C24H28F3N — CID 19613630
(E)-3-[4-[1-[4-[4-(trifluoromethyl)phenyl]cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile (PubChem CID 19613630) has the molecular formula C24H28F3N and a molecular weight of 387.49 g/mol. Its IUPAC name is (E)-3-[4-[1-[4-[4-(trifluoromethyl)phenyl]cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[1-[4-[4-(trifluoromethyl)phenyl]cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19613630 |
| Molecular Formula | C24H28F3N |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (E)-3-[4-[1-[4-[4-(trifluoromethyl)phenyl]cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile |
| SMILES | C=C(C1CCC(/C=C/C#N)CC1)C1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H28F3N/c1-17(19-6-4-18(5-7-19)3-2-16-28)20-8-10-21(11-9-20)22-12-14-23(15-13-22)24(25,26)27/h2-3,12-15,18-21H,1,4-11H2/b3-2+ |
| InChIKey | ZIOXPZBAFIWZSF-NSCUHMNNSA-N |
| XLogP | 7.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|