C26H30F3NO — CID 173304482
5-[4-[1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]cyclohexyl]penta-2,4-dienenitrile (PubChem CID 173304482) has the molecular formula C26H30F3NO and a molecular weight of 429.53 g/mol. Its IUPAC name is 5-[4-[1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]cyclohexyl]penta-2,4-dienenitrile.
| Compound Name | 5-[4-[1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]cyclohexyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 173304482 |
| Molecular Formula | C26H30F3NO |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 5-[4-[1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]cyclohexyl]penta-2,4-dienenitrile |
| SMILES | C=C(C1CCC(C=CC=CC#N)CC1)C1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H30F3NO/c1-19(21-8-6-20(7-9-21)5-3-2-4-18-30)22-10-12-23(13-11-22)24-14-16-25(17-15-24)31-26(27,28)29/h2-5,14-17,20-23H,1,6-13H2 |
| InChIKey | NHLGCOZVWNBFDJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|