C18H18F3NO — CID 19613071
(2E,4E)-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]penta-2,4-dienenitrile (PubChem CID 19613071) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is (2E,4E)-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 19613071 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2E,4E)-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]penta-2,4-dienenitrile |
| SMILES | N#C/C=C/C=C/C1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H18F3NO/c19-18(20,21)23-17-11-9-16(10-12-17)15-7-5-14(6-8-15)4-2-1-3-13-22/h1-4,9-12,14-15H,5-8H2/b3-1+,4-2+ |
| InChIKey | XZBIWPAMIMDHEW-ZPUQHVIOSA-N |
| XLogP | 5.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|