C24H29F4NO — CID 67590520
(Z)-2-fluoro-3-[4-[2-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethyl]cyclohexyl]prop-2-enenitrile (PubChem CID 67590520) has the molecular formula C24H29F4NO and a molecular weight of 423.49 g/mol. Its IUPAC name is (Z)-2-fluoro-3-[4-[2-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (Z)-2-fluoro-3-[4-[2-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 67590520 |
| Molecular Formula | C24H29F4NO |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (Z)-2-fluoro-3-[4-[2-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]ethyl]cyclohexyl]prop-2-enenitrile |
| SMILES | N#C/C(F)=C/C1CCC(CCC2CCC(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H29F4NO/c25-22(16-29)15-19-5-3-17(4-6-19)1-2-18-7-9-20(10-8-18)21-11-13-23(14-12-21)30-24(26,27)28/h11-15,17-20H,1-10H2/b22-15- |
| InChIKey | UPRFDGNWGRAKBS-JCMHNJIXSA-N |
| XLogP | 7.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|