C22H25F4NO — CID 67589332
(Z)-2-fluoro-3-[4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl]prop-2-enenitrile (PubChem CID 67589332) has the molecular formula C22H25F4NO and a molecular weight of 395.44 g/mol. Its IUPAC name is (Z)-2-fluoro-3-[4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (Z)-2-fluoro-3-[4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 67589332 |
| Molecular Formula | C22H25F4NO |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (Z)-2-fluoro-3-[4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl]prop-2-enenitrile |
| SMILES | N#C/C(F)=C/C1CCC(C2CCC(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H25F4NO/c23-20(14-27)13-15-1-3-16(4-2-15)17-5-7-18(8-6-17)19-9-11-21(12-10-19)28-22(24,25)26/h9-13,15-18H,1-8H2/b20-13- |
| InChIKey | BUJAKNOXNZSNMS-MOSHPQCFSA-N |
| XLogP | 7.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|