C25H32FN — CID 54232791
5-[4-[4-(4-ethylphenyl)cyclohexyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile (PubChem CID 54232791) has the molecular formula C25H32FN and a molecular weight of 365.54 g/mol. Its IUPAC name is 5-[4-[4-(4-ethylphenyl)cyclohexyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile.
| Compound Name | 5-[4-[4-(4-ethylphenyl)cyclohexyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54232791 |
| Molecular Formula | C25H32FN |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 5-[4-[4-(4-ethylphenyl)cyclohexyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile |
| SMILES | CCc1ccc(C2CCC(C3CCC(C=CC=C(F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H32FN/c1-2-19-6-10-21(11-7-19)23-14-16-24(17-15-23)22-12-8-20(9-13-22)4-3-5-25(26)18-27/h3-7,10-11,20,22-24H,2,8-9,12-17H2,1H3 |
| InChIKey | QKLDDAQSLYNPMV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|