C21H30 — CID 22915848
1-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclohexyl]-4-propylbenzene (PubChem CID 22915848) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclohexyl]-4-propylbenzene.
| Compound Name | 1-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclohexyl]-4-propylbenzene |
|---|---|
| PubChem CID | 22915848 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclohexyl]-4-propylbenzene |
| SMILES | CCCc1ccc(C2CCC(/C=C/C=C(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H30/c1-4-6-18-9-13-20(14-10-18)21-15-11-19(12-16-21)8-5-7-17(2)3/h5,7-10,13-14,19,21H,4,6,11-12,15-16H2,1-3H3/b8-5+ |
| InChIKey | CNOOQXPCIUICJV-VMPITWQZSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|