C22H30F2O — CID 154524141
2,2-difluoro-5-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]oxane (PubChem CID 154524141) has the molecular formula C22H30F2O and a molecular weight of 348.48 g/mol. Its IUPAC name is 2,2-difluoro-5-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]oxane.
| Compound Name | 2,2-difluoro-5-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]oxane |
|---|---|
| PubChem CID | 154524141 |
| Molecular Formula | C22H30F2O |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2,2-difluoro-5-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]oxane |
| SMILES | CCCc1ccc(C2CCC(/C=C/C3CCC(F)(F)OC3)CC2)cc1 |
| InChI | InChI=1S/C22H30F2O/c1-2-3-17-6-10-20(11-7-17)21-12-8-18(9-13-21)4-5-19-14-15-22(23,24)25-16-19/h4-7,10-11,18-19,21H,2-3,8-9,12-16H2,1H3/b5-4+ |
| InChIKey | GPTXOWSBDITOJS-SNAWJCMRSA-N |
| XLogP | 6.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|