C27H36FN — CID 67590277
5-[4-[(E)-2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile (PubChem CID 67590277) has the molecular formula C27H36FN and a molecular weight of 393.59 g/mol. Its IUPAC name is 5-[4-[(E)-2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile.
| Compound Name | 5-[4-[(E)-2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile |
|---|---|
| PubChem CID | 67590277 |
| Molecular Formula | C27H36FN |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 5-[4-[(E)-2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile |
| SMILES | CCc1ccc(C2CCC(/C=C/C3CCC(CCC=C(F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H36FN/c1-2-21-12-16-25(17-13-21)26-18-14-24(15-19-26)11-10-23-8-6-22(7-9-23)4-3-5-27(28)20-29/h5,10-13,16-17,22-24,26H,2-4,6-9,14-15,18-19H2,1H3/b11-10+,27-5? |
| InChIKey | OGTIVZUQYXSSGS-PLWACRGVSA-N |
| XLogP | 8.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|