C30H44FN — CID 67590708
(Z)-2-fluoro-5-[4-[4-[4-(4-propylphenyl)butyl]cyclohexyl]cyclohexyl]pent-2-enenitrile (PubChem CID 67590708) has the molecular formula C30H44FN and a molecular weight of 437.69 g/mol. Its IUPAC name is (Z)-2-fluoro-5-[4-[4-[4-(4-propylphenyl)butyl]cyclohexyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | (Z)-2-fluoro-5-[4-[4-[4-(4-propylphenyl)butyl]cyclohexyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 67590708 |
| Molecular Formula | C30H44FN |
| Molecular Weight | 437.69 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | (Z)-2-fluoro-5-[4-[4-[4-(4-propylphenyl)butyl]cyclohexyl]cyclohexyl]pent-2-enenitrile |
| SMILES | CCCc1ccc(CCCCC2CCC(C3CCC(CC/C=C(\F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H44FN/c1-2-6-24-11-13-25(14-12-24)7-3-4-8-26-15-19-28(20-16-26)29-21-17-27(18-22-29)9-5-10-30(31)23-32/h10-14,26-29H,2-9,15-22H2,1H3/b30-10- |
| InChIKey | JWURGZGVIORYHG-TWUOJQIPSA-N |
| XLogP | 9.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.69 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|