C26H30N2 — CID 19613827
4-[4-[1-[4-[(1E,3E)-4-cyanobuta-1,3-dienyl]cyclohexyl]ethenyl]cyclohexyl]benzonitrile (PubChem CID 19613827) has the molecular formula C26H30N2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-[4-[1-[4-[(1E,3E)-4-cyanobuta-1,3-dienyl]cyclohexyl]ethenyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[1-[4-[(1E,3E)-4-cyanobuta-1,3-dienyl]cyclohexyl]ethenyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19613827 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-[4-[1-[4-[(1E,3E)-4-cyanobuta-1,3-dienyl]cyclohexyl]ethenyl]cyclohexyl]benzonitrile |
| SMILES | C=C(C1CCC(/C=C/C=C/C#N)CC1)C1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C26H30N2/c1-20(23-10-6-21(7-11-23)5-3-2-4-18-27)24-14-16-26(17-15-24)25-12-8-22(19-28)9-13-25/h2-5,8-9,12-13,21,23-24,26H,1,6-7,10-11,14-17H2/b4-2+,5-3+ |
| InChIKey | TZCCZIMHMBUFHK-ZUVMSYQZSA-N |
| XLogP | 6.83 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|