C23H27F2N — CID 19612950
(E)-3-[4-[1-[4-(3,4-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile (PubChem CID 19612950) has the molecular formula C23H27F2N and a molecular weight of 355.47 g/mol. Its IUPAC name is (E)-3-[4-[1-[4-(3,4-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[1-[4-(3,4-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19612950 |
| Molecular Formula | C23H27F2N |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (E)-3-[4-[1-[4-(3,4-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]prop-2-enenitrile |
| SMILES | C=C(C1CCC(/C=C/C#N)CC1)C1CCC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C23H27F2N/c1-16(18-6-4-17(5-7-18)3-2-14-26)19-8-10-20(11-9-19)21-12-13-22(24)23(25)15-21/h2-3,12-13,15,17-20H,1,4-11H2/b3-2+ |
| InChIKey | ISAVQOUXGISPTK-NSCUHMNNSA-N |
| XLogP | 6.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|