C22H28Cl2 — CID 18656188
1,4-bis[4-[(E)-2-chloroethenyl]cyclohexyl]benzene (PubChem CID 18656188) has the molecular formula C22H28Cl2 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1,4-bis[4-[(E)-2-chloroethenyl]cyclohexyl]benzene.
| Compound Name | 1,4-bis[4-[(E)-2-chloroethenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 18656188 |
| Molecular Formula | C22H28Cl2 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1,4-bis[4-[(E)-2-chloroethenyl]cyclohexyl]benzene |
| SMILES | Cl/C=C/C1CCC(c2ccc(C3CCC(/C=C/Cl)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H28Cl2/c23-15-13-17-1-5-19(6-2-17)21-9-11-22(12-10-21)20-7-3-18(4-8-20)14-16-24/h9-20H,1-8H2/b15-13+,16-14+ |
| InChIKey | KVWAUIFYSHDCIL-WXUKJITCSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |