C23H33ClO — CID 18656241
1-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-4-propoxybenzene (PubChem CID 18656241) has the molecular formula C23H33ClO and a molecular weight of 360.97 g/mol. Its IUPAC name is 1-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-4-propoxybenzene.
| Compound Name | 1-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-4-propoxybenzene |
|---|---|
| PubChem CID | 18656241 |
| Molecular Formula | C23H33ClO |
| Molecular Weight | 360.97 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-4-propoxybenzene |
| SMILES | CCCOc1ccc(C2CCC(C3CCC(/C=C/Cl)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H33ClO/c1-2-17-25-23-13-11-22(12-14-23)21-9-7-20(8-10-21)19-5-3-18(4-6-19)15-16-24/h11-16,18-21H,2-10,17H2,1H3/b16-15+ |
| InChIKey | JLGGLENLXYXNOJ-FOCLMDBBSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.97 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |