C18H20F4 — CID 22915757
2-fluoro-4-[4-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]-1-(trifluoromethyl)benzene (PubChem CID 22915757) has the molecular formula C18H20F4 and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[4-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22915757 |
| Molecular Formula | C18H20F4 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-fluoro-4-[4-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]-1-(trifluoromethyl)benzene |
| SMILES | C/C=C/C=C/C1CCC(c2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H20F4/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-11-16(17(19)12-15)18(20,21)22/h2-5,10-14H,6-9H2,1H3/b3-2+,5-4+ |
| InChIKey | PNTUHYOAFATDDF-MQQKCMAXSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|