C24H31F5 — CID 19695440
2-fluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene (PubChem CID 19695440) has the molecular formula C24H31F5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-fluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 19695440 |
| Molecular Formula | C24H31F5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-fluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene |
| SMILES | FCCC/C=C/C1CCC(C2CCC(c3ccc(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H31F5/c25-15-3-1-2-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-14-22(23(26)16-21)24(27,28)29/h2,4,13-14,16-20H,1,3,5-12,15H2/b4-2+ |
| InChIKey | GPNKJVZUUWNOIA-DUXPYHPUSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|