C25H36F4 — CID 19702487
2-fluoro-4-[4-[4-(4-methylpentyl)cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene (PubChem CID 19702487) has the molecular formula C25H36F4 and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-fluoro-4-[4-[4-(4-methylpentyl)cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[4-[4-(4-methylpentyl)cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 19702487 |
| Molecular Formula | C25H36F4 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 2-fluoro-4-[4-[4-(4-methylpentyl)cyclohexyl]cyclohexyl]-1-(trifluoromethyl)benzene |
| SMILES | CC(C)CCCC1CCC(C2CCC(c3ccc(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H36F4/c1-17(2)4-3-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-15-23(24(26)16-22)25(27,28)29/h14-21H,3-13H2,1-2H3 |
| InChIKey | GYLWQBWBYRALNK-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |