C25H28F6 — CID 19702579
1,3,4-trifluoro-5-[4-[4-(4-methylpentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene (PubChem CID 19702579) has the molecular formula C25H28F6 and a molecular weight of 442.49 g/mol. Its IUPAC name is 1,3,4-trifluoro-5-[4-[4-(4-methylpentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3,4-trifluoro-5-[4-[4-(4-methylpentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 19702579 |
| Molecular Formula | C25H28F6 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1,3,4-trifluoro-5-[4-[4-(4-methylpentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene |
| SMILES | CC(C)CCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)F)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C25H28F6/c1-15(2)4-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-21(26)22(25(29,30)31)24(28)23(20)27/h10-17H,3-9H2,1-2H3 |
| InChIKey | HGTUOCFQRCXIIE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|