C24H32F4 — CID 22044576
2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 22044576) has the molecular formula C24H32F4 and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | 2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 22044576 |
| Molecular Formula | C24H32F4 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CCCC1CCC2C(CCC3CC(c4ccc(C(F)(F)F)c(F)c4)CCC32)C1 |
| InChI | InChI=1S/C24H32F4/c1-2-3-15-4-9-20-18(12-15)5-6-19-13-16(7-10-21(19)20)17-8-11-22(23(25)14-17)24(26,27)28/h8,11,14-16,18-21H,2-7,9-10,12-13H2,1H3 |
| InChIKey | CKHDJTWDEKCXSF-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |