C25H34F4O — CID 139870302
2-(4-ethoxycyclohexyl)-6-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870302) has the molecular formula C25H34F4O and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(4-ethoxycyclohexyl)-6-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(4-ethoxycyclohexyl)-6-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870302 |
| Molecular Formula | C25H34F4O |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-(4-ethoxycyclohexyl)-6-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCOC1CCC(C2CCC3CC(c4ccc(C(F)(F)F)c(F)c4)CCC3C2)CC1 |
| InChI | InChI=1S/C25H34F4O/c1-2-30-22-10-7-16(8-11-22)17-3-4-19-14-20(6-5-18(19)13-17)21-9-12-23(24(26)15-21)25(27,28)29/h9,12,15-20,22H,2-8,10-11,13-14H2,1H3 |
| InChIKey | WHMGOVBPSJBUKO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |