C27H28F4O — CID 139866305
2-ethoxy-6-[3-fluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866305) has the molecular formula C27H28F4O and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-ethoxy-6-[3-fluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-ethoxy-6-[3-fluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866305 |
| Molecular Formula | C27H28F4O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-ethoxy-6-[3-fluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCOC1CCC2CC(c3ccc(C#Cc4ccc(C(F)(F)F)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H28F4O/c1-2-32-25-14-11-21-15-20(9-10-22(21)16-25)23-8-7-19(26(28)17-23)6-3-18-4-12-24(13-5-18)27(29,30)31/h4-5,7-8,12-13,17,20-22,25H,2,9-11,14-16H2,1H3 |
| InChIKey | YQTCQQTZWOPEJC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|