C26H29F — CID 20809824
(2R,4aR,8aR)-2-[3-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809824) has the molecular formula C26H29F and a molecular weight of 360.52 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[3-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[3-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809824 |
| Molecular Formula | C26H29F |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2R,4aR,8aR)-2-[3-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | Cc1ccc(C#Cc2ccc([C@@H]3CC[C@@H]4CC(C)CC[C@@H]4C3)cc2F)cc1 |
| InChI | InChI=1S/C26H29F/c1-18-3-6-20(7-4-18)8-10-21-11-12-25(17-26(21)27)24-14-13-22-15-19(2)5-9-23(22)16-24/h3-4,6-7,11-12,17,19,22-24H,5,9,13-16H2,1-2H3/t19?,22-,23-,24-/m1/s1 |
| InChIKey | DYPNFZVNTMHZES-RDJJLVMJSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|