C27H27ClF2 — CID 139868467
2-[4-[2-(4-chloro-3-fluorophenyl)ethynyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868467) has the molecular formula C27H27ClF2 and a molecular weight of 424.96 g/mol. Its IUPAC name is 2-[4-[2-(4-chloro-3-fluorophenyl)ethynyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-(4-chloro-3-fluorophenyl)ethynyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868467 |
| Molecular Formula | C27H27ClF2 |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[4-[2-(4-chloro-3-fluorophenyl)ethynyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3ccc(C#Cc4ccc(Cl)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H27ClF2/c1-2-3-18-5-8-22-16-23(12-11-21(22)14-18)24-10-9-20(26(29)17-24)7-4-19-6-13-25(28)27(30)15-19/h2-3,6,9-10,13,15,17-18,21-23H,5,8,11-12,14,16H2,1H3/b3-2+ |
| InChIKey | XDLXWTYBCMKDHW-NSCUHMNNSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|