C25H34ClF — CID 22045322
2-(4-chloro-3-fluorophenyl)-7-[(E)-pent-1-enyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 22045322) has the molecular formula C25H34ClF and a molecular weight of 389.00 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-7-[(E)-pent-1-enyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-7-[(E)-pent-1-enyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 22045322 |
| Molecular Formula | C25H34ClF |
| Molecular Weight | 389.00 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-7-[(E)-pent-1-enyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CCC/C=C/C1CCC2C(CCC3CC(c4ccc(Cl)c(F)c4)CCC32)C1 |
| InChI | InChI=1S/C25H34ClF/c1-2-3-4-5-17-6-11-22-20(14-17)7-8-21-15-18(9-12-23(21)22)19-10-13-24(26)25(27)16-19/h4-5,10,13,16-18,20-23H,2-3,6-9,11-12,14-15H2,1H3/b5-4+ |
| InChIKey | QYUDUWQOSWNTJP-SNAWJCMRSA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.00 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|