C22H28ClFO2 — CID 67844235
4-[4-[4-(4-chloro-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid (PubChem CID 67844235) has the molecular formula C22H28ClFO2 and a molecular weight of 378.92 g/mol. Its IUPAC name is 4-[4-[4-(4-chloro-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid.
| Compound Name | 4-[4-[4-(4-chloro-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid |
|---|---|
| PubChem CID | 67844235 |
| Molecular Formula | C22H28ClFO2 |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-[4-[4-(4-chloro-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid |
| SMILES | O=C(O)CC=CC1CCC(C2CCC(c3ccc(Cl)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H28ClFO2/c23-20-13-12-19(14-21(20)24)18-10-8-17(9-11-18)16-6-4-15(5-7-16)2-1-3-22(25)26/h1-2,12-18H,3-11H2,(H,25,26) |
| InChIKey | FPAHZZPJSXQDKG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|