C25H34F2O — CID 22045656
2-[(E)-but-1-enyl]-7-[4-(difluoromethoxy)phenyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 22045656) has the molecular formula C25H34F2O and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-7-[4-(difluoromethoxy)phenyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | 2-[(E)-but-1-enyl]-7-[4-(difluoromethoxy)phenyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 22045656 |
| Molecular Formula | C25H34F2O |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[(E)-but-1-enyl]-7-[4-(difluoromethoxy)phenyl]-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CC/C=C/C1CCC2C(CCC3CC(c4ccc(OC(F)F)cc4)CCC32)C1 |
| InChI | InChI=1S/C25H34F2O/c1-2-3-4-17-5-13-23-20(15-17)6-7-21-16-19(10-14-24(21)23)18-8-11-22(12-9-18)28-25(26)27/h3-4,8-9,11-12,17,19-21,23-25H,2,5-7,10,13-16H2,1H3/b4-3+ |
| InChIKey | DZLSIGZTJMTDQB-ONEGZZNKSA-N |
| XLogP | 7.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|