C20H28O — CID 22385090
2-(4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22385090) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22385090 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3ccc(OC)cc3)CCC2C1 |
| InChI | InChI=1S/C20H28O/c1-3-4-15-5-6-19-14-18(8-7-17(19)13-15)16-9-11-20(21-2)12-10-16/h3-4,9-12,15,17-19H,5-8,13-14H2,1-2H3/b4-3+ |
| InChIKey | HMRJDIHCURTUNV-ONEGZZNKSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|