C27H30F2O3 — CID 139870546
(2-fluoro-4-methoxyphenyl) 2-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139870546) has the molecular formula C27H30F2O3 and a molecular weight of 440.53 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl) 2-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | (2-fluoro-4-methoxyphenyl) 2-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139870546 |
| Molecular Formula | C27H30F2O3 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl) 2-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/C1CCC2CC(c3ccc(C(=O)Oc4ccc(OC)cc4F)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H30F2O3/c1-3-4-17-5-6-19-14-20(8-7-18(19)13-17)21-9-11-23(24(28)15-21)27(30)32-26-12-10-22(31-2)16-25(26)29/h3-4,9-12,15-20H,5-8,13-14H2,1-2H3/b4-3+ |
| InChIKey | SDJAOYNOEBUXBD-ONEGZZNKSA-N |
| XLogP | 7.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|