C28H29F3O3 — CID 139868943
(2,3-difluoro-4-prop-2-enoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate (PubChem CID 139868943) has the molecular formula C28H29F3O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is (2,3-difluoro-4-prop-2-enoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate.
| Compound Name | (2,3-difluoro-4-prop-2-enoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 139868943 |
| Molecular Formula | C28H29F3O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (2,3-difluoro-4-prop-2-enoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate |
| SMILES | C=CCOc1ccc(OC(=O)c2ccc(C3CCC4CC(C=C)CCC4C3)cc2F)c(F)c1F |
| InChI | InChI=1S/C28H29F3O3/c1-3-13-33-24-11-12-25(27(31)26(24)30)34-28(32)22-10-9-21(16-23(22)29)20-8-7-18-14-17(4-2)5-6-19(18)15-20/h3-4,9-12,16-20H,1-2,5-8,13-15H2 |
| InChIKey | HMONSFPKBHXMNX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|