C18H22F2 — CID 20809609
(4aR,6R,8aR)-2-(3,4-difluorophenyl)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809609) has the molecular formula C18H22F2 and a molecular weight of 276.37 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-(3,4-difluorophenyl)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-(3,4-difluorophenyl)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809609 |
| Molecular Formula | C18H22F2 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (4aR,6R,8aR)-2-(3,4-difluorophenyl)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=C[C@@H]1CC[C@@H]2CC(c3ccc(F)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C18H22F2/c1-2-12-3-4-14-10-15(6-5-13(14)9-12)16-7-8-17(19)18(20)11-16/h2,7-8,11-15H,1,3-6,9-10H2/t12-,13-,14-,15?/m1/s1 |
| InChIKey | OGKUUVSVACHIAV-CBNXCZCTSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|