C24H23ClF4 — CID 139868293
2-[4-(4-chloro-3,5-difluorophenyl)-3,5-difluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868293) has the molecular formula C24H23ClF4 and a molecular weight of 422.89 g/mol. Its IUPAC name is 2-[4-(4-chloro-3,5-difluorophenyl)-3,5-difluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-(4-chloro-3,5-difluorophenyl)-3,5-difluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868293 |
| Molecular Formula | C24H23ClF4 |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[4-(4-chloro-3,5-difluorophenyl)-3,5-difluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CC1CCC2CC(c3cc(F)c(-c4cc(F)c(Cl)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C24H23ClF4/c1-2-13-3-4-15-8-16(6-5-14(15)7-13)17-9-19(26)23(20(27)10-17)18-11-21(28)24(25)22(29)12-18/h2,9-16H,1,3-8H2 |
| InChIKey | BIBUXJWAXOWYBW-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|