C29H33FO3 — CID 139868440
[4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 139868440) has the molecular formula C29H33FO3 and a molecular weight of 448.58 g/mol. Its IUPAC name is [4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | [4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 139868440 |
| Molecular Formula | C29H33FO3 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | C=CC1CCC2CC(c3ccc(C(=O)Oc4ccc(OC/C=C/C)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C29H33FO3/c1-3-5-16-32-28-15-14-26(19-27(28)30)33-29(31)22-10-8-21(9-11-22)24-13-12-23-17-20(4-2)6-7-25(23)18-24/h3-5,8-11,14-15,19-20,23-25H,2,6-7,12-13,16-18H2,1H3/b5-3+ |
| InChIKey | QAMDNKSUAKIMIV-HWKANZROSA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|