C30H34F2O3 — CID 139870457
[4-[(E)-but-2-enoxy]-3-fluorophenyl] 3-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139870457) has the molecular formula C30H34F2O3 and a molecular weight of 480.60 g/mol. Its IUPAC name is [4-[(E)-but-2-enoxy]-3-fluorophenyl] 3-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | [4-[(E)-but-2-enoxy]-3-fluorophenyl] 3-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139870457 |
| Molecular Formula | C30H34F2O3 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | [4-[(E)-but-2-enoxy]-3-fluorophenyl] 3-fluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/COc1ccc(OC(=O)c2ccc(C3CCC4CC(/C=C/C)CCC4C3)c(F)c2)cc1F |
| InChI | InChI=1S/C30H34F2O3/c1-3-5-15-34-29-14-12-25(19-28(29)32)35-30(33)24-11-13-26(27(31)18-24)23-10-9-21-16-20(6-4-2)7-8-22(21)17-23/h3-6,11-14,18-23H,7-10,15-17H2,1-2H3/b5-3+,6-4+ |
| InChIKey | DCFFCHMYVLAPSP-GGWOSOGESA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|