C27H28F4O3 — CID 139870145
[4-(difluoromethoxy)phenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139870145) has the molecular formula C27H28F4O3 and a molecular weight of 476.51 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | [4-(difluoromethoxy)phenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139870145 |
| Molecular Formula | C27H28F4O3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [4-(difluoromethoxy)phenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/C1CCC2CC(c3c(F)cc(C(=O)Oc4ccc(OC(F)F)cc4)cc3F)CCC2C1 |
| InChI | InChI=1S/C27H28F4O3/c1-2-3-16-4-5-18-13-19(7-6-17(18)12-16)25-23(28)14-20(15-24(25)29)26(32)33-21-8-10-22(11-9-21)34-27(30)31/h2-3,8-11,14-19,27H,4-7,12-13H2,1H3/b3-2+ |
| InChIKey | PVQCUBNXWFIYLM-NSCUHMNNSA-N |
| XLogP | 7.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|