C27H26F6O3 — CID 139870303
[4-(difluoromethoxy)-3,5-difluorophenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139870303) has the molecular formula C27H26F6O3 and a molecular weight of 512.49 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139870303 |
| Molecular Formula | C27H26F6O3 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 3,5-difluoro-4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/C1CCC2CC(c3c(F)cc(C(=O)Oc4cc(F)c(OC(F)F)c(F)c4)cc3F)CCC2C1 |
| InChI | InChI=1S/C27H26F6O3/c1-2-3-14-4-5-16-9-17(7-6-15(16)8-14)24-20(28)10-18(11-21(24)29)26(34)35-19-12-22(30)25(23(31)13-19)36-27(32)33/h2-3,10-17,27H,4-9H2,1H3/b3-2+ |
| InChIKey | CYYOGUYVLHGGCI-NSCUHMNNSA-N |
| XLogP | 7.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|