C29H32F2O2 — CID 139869147
(4-but-3-enylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate (PubChem CID 139869147) has the molecular formula C29H32F2O2 and a molecular weight of 450.57 g/mol. Its IUPAC name is (4-but-3-enylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate.
| Compound Name | (4-but-3-enylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 139869147 |
| Molecular Formula | C29H32F2O2 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (4-but-3-enylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate |
| SMILES | C=CCCc1ccc(OC(=O)c2cc(F)c(C3CCC4CC(C=C)CCC4C3)c(F)c2)cc1 |
| InChI | InChI=1S/C29H32F2O2/c1-3-5-6-20-8-13-25(14-9-20)33-29(32)24-17-26(30)28(27(31)18-24)23-12-11-21-15-19(4-2)7-10-22(21)16-23/h3-4,8-9,13-14,17-19,21-23H,1-2,5-7,10-12,15-16H2 |
| InChIKey | YIGYDRKSCDCYJK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|