C20H26ClFO — CID 139866077
2-[(E)-but-2-enoxy]-6-(4-chloro-3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866077) has the molecular formula C20H26ClFO and a molecular weight of 336.88 g/mol. Its IUPAC name is 2-[(E)-but-2-enoxy]-6-(4-chloro-3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[(E)-but-2-enoxy]-6-(4-chloro-3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866077 |
| Molecular Formula | C20H26ClFO |
| Molecular Weight | 336.88 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[(E)-but-2-enoxy]-6-(4-chloro-3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/COC1CCC2CC(c3ccc(Cl)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C20H26ClFO/c1-2-3-10-23-18-8-6-15-11-14(4-5-16(15)12-18)17-7-9-19(21)20(22)13-17/h2-3,7,9,13-16,18H,4-6,8,10-12H2,1H3/b3-2+ |
| InChIKey | PUQWCJJYIVZAHS-NSCUHMNNSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.88 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|