C25H35FO — CID 139865466
6-[6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 139865466) has the molecular formula C25H35FO and a molecular weight of 370.55 g/mol. Its IUPAC name is 6-[6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139865466 |
| Molecular Formula | C25H35FO |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 6-[6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/COC1CCC2CC(c3cc(F)c4c(c3)CCC(C)C4)CCC2C1 |
| InChI | InChI=1S/C25H35FO/c1-3-4-11-27-23-10-9-18-13-19(7-8-20(18)15-23)22-14-21-6-5-17(2)12-24(21)25(26)16-22/h3-4,14,16-20,23H,5-13,15H2,1-2H3/b4-3+ |
| InChIKey | NSPYFLHMOUAARX-ONEGZZNKSA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|