C26H31F — CID 139868059
2-[3-fluoro-4-(4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868059) has the molecular formula C26H31F and a molecular weight of 362.53 g/mol. Its IUPAC name is 2-[3-fluoro-4-(4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[3-fluoro-4-(4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868059 |
| Molecular Formula | C26H31F |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[3-fluoro-4-(4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3ccc(-c4ccc(C)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C26H31F/c1-3-4-19-7-10-22-16-23(12-11-21(22)15-19)24-13-14-25(26(27)17-24)20-8-5-18(2)6-9-20/h3-6,8-9,13-14,17,19,21-23H,7,10-12,15-16H2,1-2H3/b4-3+ |
| InChIKey | OFLXSVBTKKSIPS-ONEGZZNKSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|